C18H20N4O2 — CID 135584974
2-amino-6-(2-hydroxy-6-methoxyphenyl)-4-piperidin-3-ylpyridine-3-carbonitrile (PubChem CID 135584974) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-amino-6-(2-hydroxy-6-methoxyphenyl)-4-piperidin-3-ylpyridine-3-carbonitrile.
| Compound Name | 2-amino-6-(2-hydroxy-6-methoxyphenyl)-4-piperidin-3-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135584974 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-amino-6-(2-hydroxy-6-methoxyphenyl)-4-piperidin-3-ylpyridine-3-carbonitrile |
| SMILES | COc1cccc(O)c1-c1cc(C2CCCNC2)c(C#N)c(N)n1 |
| InChI | InChI=1S/C18H20N4O2/c1-24-16-6-2-5-15(23)17(16)14-8-12(11-4-3-7-21-10-11)13(9-19)18(20)22-14/h2,5-6,8,11,21,23H,3-4,7,10H2,1H3,(H2,20,22) |
| InChIKey | DABRFLSFDBXABL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |