C17H18N4O — CID 135584980
2-amino-6-(2-hydroxyphenyl)-4-piperidin-2-ylpyridine-3-carbonitrile (PubChem CID 135584980) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-amino-6-(2-hydroxyphenyl)-4-piperidin-2-ylpyridine-3-carbonitrile.
| Compound Name | 2-amino-6-(2-hydroxyphenyl)-4-piperidin-2-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135584980 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-amino-6-(2-hydroxyphenyl)-4-piperidin-2-ylpyridine-3-carbonitrile |
| SMILES | N#Cc1c(C2CCCCN2)cc(-c2ccccc2O)nc1N |
| InChI | InChI=1S/C17H18N4O/c18-10-13-12(14-6-3-4-8-20-14)9-15(21-17(13)19)11-5-1-2-7-16(11)22/h1-2,5,7,9,14,20,22H,3-4,6,8H2,(H2,19,21) |
| InChIKey | NSOIZUKCTOHQJE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 94.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |