C26H27N5O2 — CID 135456003
N-[3-[2-amino-3-cyano-6-(2-hydroxyphenyl)-4-pyridinyl]phenyl]-3-piperidin-1-ylpropanamide (PubChem CID 135456003) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is N-[3-[2-amino-3-cyano-6-(2-hydroxyphenyl)-4-pyridinyl]phenyl]-3-piperidin-1-ylpropanamide.
| Compound Name | N-[3-[2-amino-3-cyano-6-(2-hydroxyphenyl)-4-pyridinyl]phenyl]-3-piperidin-1-ylpropanamide |
|---|---|
| PubChem CID | 135456003 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | N-[3-[2-amino-3-cyano-6-(2-hydroxyphenyl)-4-pyridinyl]phenyl]-3-piperidin-1-ylpropanamide |
| SMILES | N#Cc1c(-c2cccc(NC(=O)CCN3CCCCC3)c2)cc(-c2ccccc2O)nc1N |
| InChI | InChI=1S/C26H27N5O2/c27-17-22-21(16-23(30-26(22)28)20-9-2-3-10-24(20)32)18-7-6-8-19(15-18)29-25(33)11-14-31-12-4-1-5-13-31/h2-3,6-10,15-16,32H,1,4-5,11-14H2,(H2,28,30)(H,29,33) |
| InChIKey | OGKJHWSTJKFLOO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |