C14H9ClN4O4S — CID 135585370
(2Z)-2-[[5-(3-chloro-4-nitrophenyl)furan-2-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135585370) has the molecular formula C14H9ClN4O4S and a molecular weight of 364.77 g/mol. Its IUPAC name is (2Z)-2-[[5-(3-chloro-4-nitrophenyl)furan-2-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-2-[[5-(3-chloro-4-nitrophenyl)furan-2-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135585370 |
| Molecular Formula | C14H9ClN4O4S |
| Molecular Weight | 364.77 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | (2Z)-2-[[5-(3-chloro-4-nitrophenyl)furan-2-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N\N=Cc2ccc(-c3ccc([N+](=O)[O-])c(Cl)c3)o2)N1 |
| InChI | InChI=1S/C14H9ClN4O4S/c15-10-5-8(1-3-11(10)19(21)22)12-4-2-9(23-12)6-16-18-14-17-13(20)7-24-14/h1-6H,7H2,(H,17,18,20) |
| InChIKey | VVCCUBVCJLLBPX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.77 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|