C14H9Cl2N3O2S — CID 137127383
2-[(Z)-[5-(3,5-dichlorophenyl)furan-2-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 137127383) has the molecular formula C14H9Cl2N3O2S and a molecular weight of 354.22 g/mol. Its IUPAC name is 2-[(Z)-[5-(3,5-dichlorophenyl)furan-2-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[(Z)-[5-(3,5-dichlorophenyl)furan-2-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137127383 |
| Molecular Formula | C14H9Cl2N3O2S |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | 2-[(Z)-[5-(3,5-dichlorophenyl)furan-2-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(=N/N=C\c2ccc(-c3cc(Cl)cc(Cl)c3)o2)N1 |
| InChI | InChI=1S/C14H9Cl2N3O2S/c15-9-3-8(4-10(16)5-9)12-2-1-11(21-12)6-17-19-14-18-13(20)7-22-14/h1-6H,7H2,(H,18,19,20)/b17-6- |
| InChIKey | XDAPCNINOYKLSK-FMQZQXMHSA-N |
| XLogP | 3.81 |
| TPSA | 66.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|