About 5-methyl-N-phenyl-6H-indolo[2,3-b]quinolin-11-imine
5-methyl-N-phenyl-6H-indolo[2,3-b]quinolin-11-imine (PubChem CID 135585429) has the molecular formula C22H17N3
and a molecular weight of 323.40 g/mol. Its IUPAC name is 5-methyl-N-phenyl-6H-indolo[2,3-b]quinolin-11-imine.
Molecular Properties
| Compound Name | 5-methyl-N-phenyl-6H-indolo[2,3-b]quinolin-11-imine |
| PubChem CID | 135585429 |
| Molecular Formula | C22H17N3 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 5-methyl-N-phenyl-6H-indolo[2,3-b]quinolin-11-imine |
| SMILES | Cn1c2ccccc2/c(=N\c2ccccc2)c2c3ccccc3[nH]c21 |
| InChI | InChI=1S/C22H17N3/c1-25-19-14-8-6-12-17(19)21(23-15-9-3-2-4-10-15)20-16-11-5-7-13-18(16)24-22(20)25/h2-14,24H,1H3/b23-21+ |
| InChIKey | TUODYPNSPPCXSX-XTQSDGFTSA-N |
| XLogP | 5.05 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-N-phenyl-6H-indolo[2,3-b]quinolin-11-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-phenyl-6H-indolo[2,3-b]quinolin-11-imine?
The IUPAC name of 5-methyl-N-phenyl-6H-indolo[2,3-b]quinolin-11-imine (CID 135585429) is 5-methyl-N-phenyl-6H-indolo[2,3-b]quinolin-11-imine.
What is the SMILES notation for 5-methyl-N-phenyl-6H-indolo[2,3-b]quinolin-11-imine?
The canonical SMILES for 5-methyl-N-phenyl-6H-indolo[2,3-b]quinolin-11-imine is Cn1c2ccccc2/c(=N\c2ccccc2)c2c3ccccc3[nH]c21.
What is the InChIKey of 5-methyl-N-phenyl-6H-indolo[2,3-b]quinolin-11-imine?
The InChIKey is TUODYPNSPPCXSX-XTQSDGFTSA-N. The full InChI is InChI=1S/C22H17N3/c1-25-19-14-8-6-12-17(19)21(23-15-9-3-2-4-10-15)20-16-11-5-7-13-18(16)24-22(20)25/h2-14,24H,1H3/b23-21+.
What are the key properties of 5-methyl-N-phenyl-6H-indolo[2,3-b]quinolin-11-imine?
5-methyl-N-phenyl-6H-indolo[2,3-b]quinolin-11-imine has a molecular weight of 323.40 g/mol, XLogP of 5.05, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-phenyl-6H-indolo[2,3-b]quinolin-11-imine is sourced from PubChem (CID 135585429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).