C30H37N3O5 — CID 135586657
4-(3-ethoxy-4-prop-2-enoxyphenyl)-3-(2-hydroxy-3,5-dimethylphenyl)-5-(3-propan-2-yloxypropyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 135586657) has the molecular formula C30H37N3O5 and a molecular weight of 519.64 g/mol. Its IUPAC name is 4-(3-ethoxy-4-prop-2-enoxyphenyl)-3-(2-hydroxy-3,5-dimethylphenyl)-5-(3-propan-2-yloxypropyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 4-(3-ethoxy-4-prop-2-enoxyphenyl)-3-(2-hydroxy-3,5-dimethylphenyl)-5-(3-propan-2-yloxypropyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 135586657 |
| Molecular Formula | C30H37N3O5 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | 4-(3-ethoxy-4-prop-2-enoxyphenyl)-3-(2-hydroxy-3,5-dimethylphenyl)-5-(3-propan-2-yloxypropyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | C=CCOc1ccc(C2c3c(-c4cc(C)cc(C)c4O)n[nH]c3C(=O)N2CCCOC(C)C)cc1OCC |
| InChI | InChI=1S/C30H37N3O5/c1-7-13-38-23-11-10-21(17-24(23)36-8-2)28-25-26(22-16-19(5)15-20(6)29(22)34)31-32-27(25)30(35)33(28)12-9-14-37-18(3)4/h7,10-11,15-18,28,34H,1,8-9,12-14H2,2-6H3,(H,31,32) |
| InChIKey | FFYYTFPZSXGQRK-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|