C26H29N3O4 — CID 135586005
3-(2-hydroxy-3,5-dimethylphenyl)-5-(3-methoxypropyl)-4-(4-prop-2-enoxyphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 135586005) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 3-(2-hydroxy-3,5-dimethylphenyl)-5-(3-methoxypropyl)-4-(4-prop-2-enoxyphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 3-(2-hydroxy-3,5-dimethylphenyl)-5-(3-methoxypropyl)-4-(4-prop-2-enoxyphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 135586005 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 3-(2-hydroxy-3,5-dimethylphenyl)-5-(3-methoxypropyl)-4-(4-prop-2-enoxyphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | C=CCOc1ccc(C2c3c(-c4cc(C)cc(C)c4O)n[nH]c3C(=O)N2CCCOC)cc1 |
| InChI | InChI=1S/C26H29N3O4/c1-5-12-33-19-9-7-18(8-10-19)24-21-22(20-15-16(2)14-17(3)25(20)30)27-28-23(21)26(31)29(24)11-6-13-32-4/h5,7-10,14-15,24,30H,1,6,11-13H2,2-4H3,(H,27,28) |
| InChIKey | HJZMINOSOTVXGC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|