C25H26ClN3O3 — CID 135669743
3-(5-chloro-2-hydroxyphenyl)-5-pentyl-4-(4-prop-2-enoxyphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 135669743) has the molecular formula C25H26ClN3O3 and a molecular weight of 451.95 g/mol. Its IUPAC name is 3-(5-chloro-2-hydroxyphenyl)-5-pentyl-4-(4-prop-2-enoxyphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 3-(5-chloro-2-hydroxyphenyl)-5-pentyl-4-(4-prop-2-enoxyphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 135669743 |
| Molecular Formula | C25H26ClN3O3 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 3-(5-chloro-2-hydroxyphenyl)-5-pentyl-4-(4-prop-2-enoxyphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | C=CCOc1ccc(C2c3c(-c4cc(Cl)ccc4O)n[nH]c3C(=O)N2CCCCC)cc1 |
| InChI | InChI=1S/C25H26ClN3O3/c1-3-5-6-13-29-24(16-7-10-18(11-8-16)32-14-4-2)21-22(27-28-23(21)25(29)31)19-15-17(26)9-12-20(19)30/h4,7-12,15,24,30H,2-3,5-6,13-14H2,1H3,(H,27,28) |
| InChIKey | GTTVPDNKXYHQNK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|