C31H32ClN3O3 — CID 135669972
3-(5-chloro-2-hydroxyphenyl)-4-(4-hexoxyphenyl)-5-[(4-methylphenyl)methyl]-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 135669972) has the molecular formula C31H32ClN3O3 and a molecular weight of 530.07 g/mol. Its IUPAC name is 3-(5-chloro-2-hydroxyphenyl)-4-(4-hexoxyphenyl)-5-[(4-methylphenyl)methyl]-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 3-(5-chloro-2-hydroxyphenyl)-4-(4-hexoxyphenyl)-5-[(4-methylphenyl)methyl]-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 135669972 |
| Molecular Formula | C31H32ClN3O3 |
| Molecular Weight | 530.07 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 3-(5-chloro-2-hydroxyphenyl)-4-(4-hexoxyphenyl)-5-[(4-methylphenyl)methyl]-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | CCCCCCOc1ccc(C2c3c(-c4cc(Cl)ccc4O)n[nH]c3C(=O)N2Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H32ClN3O3/c1-3-4-5-6-17-38-24-14-11-22(12-15-24)30-27-28(25-18-23(32)13-16-26(25)36)33-34-29(27)31(37)35(30)19-21-9-7-20(2)8-10-21/h7-16,18,30,36H,3-6,17,19H2,1-2H3,(H,33,34) |
| InChIKey | DXOOZSBXNLJKIJ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.07 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|