C29H27Cl2N3O3 — CID 135670003
3-(5-chloro-2-hydroxyphenyl)-5-[(2-chlorophenyl)methyl]-4-(4-pentoxyphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 135670003) has the molecular formula C29H27Cl2N3O3 and a molecular weight of 536.46 g/mol. Its IUPAC name is 3-(5-chloro-2-hydroxyphenyl)-5-[(2-chlorophenyl)methyl]-4-(4-pentoxyphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 3-(5-chloro-2-hydroxyphenyl)-5-[(2-chlorophenyl)methyl]-4-(4-pentoxyphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 135670003 |
| Molecular Formula | C29H27Cl2N3O3 |
| Molecular Weight | 536.46 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | 3-(5-chloro-2-hydroxyphenyl)-5-[(2-chlorophenyl)methyl]-4-(4-pentoxyphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | CCCCCOc1ccc(C2c3c(-c4cc(Cl)ccc4O)n[nH]c3C(=O)N2Cc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C29H27Cl2N3O3/c1-2-3-6-15-37-21-12-9-18(10-13-21)28-25-26(22-16-20(30)11-14-24(22)35)32-33-27(25)29(36)34(28)17-19-7-4-5-8-23(19)31/h4-5,7-14,16,28,35H,2-3,6,15,17H2,1H3,(H,32,33) |
| InChIKey | YNVJRZBJMCSERJ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.46 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|