C29H28ClN3O4 — CID 135670113
4-(3-butoxyphenyl)-3-(5-chloro-2-hydroxyphenyl)-5-[(4-methoxyphenyl)methyl]-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 135670113) has the molecular formula C29H28ClN3O4 and a molecular weight of 518.01 g/mol. Its IUPAC name is 4-(3-butoxyphenyl)-3-(5-chloro-2-hydroxyphenyl)-5-[(4-methoxyphenyl)methyl]-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 4-(3-butoxyphenyl)-3-(5-chloro-2-hydroxyphenyl)-5-[(4-methoxyphenyl)methyl]-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 135670113 |
| Molecular Formula | C29H28ClN3O4 |
| Molecular Weight | 518.01 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | 4-(3-butoxyphenyl)-3-(5-chloro-2-hydroxyphenyl)-5-[(4-methoxyphenyl)methyl]-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | CCCCOc1cccc(C2c3c(-c4cc(Cl)ccc4O)n[nH]c3C(=O)N2Cc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C29H28ClN3O4/c1-3-4-14-37-22-7-5-6-19(15-22)28-25-26(23-16-20(30)10-13-24(23)34)31-32-27(25)29(35)33(28)17-18-8-11-21(36-2)12-9-18/h5-13,15-16,28,34H,3-4,14,17H2,1-2H3,(H,31,32) |
| InChIKey | BVYDTEKIWHFPAM-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.01 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|