C31H32ClN3O5 — CID 135670215
4-(3-butoxyphenyl)-3-(5-chloro-2-hydroxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl]-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 135670215) has the molecular formula C31H32ClN3O5 and a molecular weight of 562.07 g/mol. Its IUPAC name is 4-(3-butoxyphenyl)-3-(5-chloro-2-hydroxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl]-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 4-(3-butoxyphenyl)-3-(5-chloro-2-hydroxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl]-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 135670215 |
| Molecular Formula | C31H32ClN3O5 |
| Molecular Weight | 562.07 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | 4-(3-butoxyphenyl)-3-(5-chloro-2-hydroxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl]-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | CCCCOc1cccc(C2c3c(-c4cc(Cl)ccc4O)n[nH]c3C(=O)N2CCc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C31H32ClN3O5/c1-4-5-15-40-22-8-6-7-20(17-22)30-27-28(23-18-21(32)10-11-24(23)36)33-34-29(27)31(37)35(30)14-13-19-9-12-25(38-2)26(16-19)39-3/h6-12,16-18,30,36H,4-5,13-15H2,1-3H3,(H,33,34) |
| InChIKey | FHVKTVOILIBWIU-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.07 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|