C29H28ClN3O2 — CID 43856994
4-(4-butoxyphenyl)-5-[(4-chlorophenyl)methyl]-3-(4-methylphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 43856994) has the molecular formula C29H28ClN3O2 and a molecular weight of 486.02 g/mol. Its IUPAC name is 4-(4-butoxyphenyl)-5-[(4-chlorophenyl)methyl]-3-(4-methylphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 4-(4-butoxyphenyl)-5-[(4-chlorophenyl)methyl]-3-(4-methylphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 43856994 |
| Molecular Formula | C29H28ClN3O2 |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | 4-(4-butoxyphenyl)-5-[(4-chlorophenyl)methyl]-3-(4-methylphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | CCCCOc1ccc(C2c3c(-c4ccc(C)cc4)n[nH]c3C(=O)N2Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C29H28ClN3O2/c1-3-4-17-35-24-15-11-22(12-16-24)28-25-26(21-9-5-19(2)6-10-21)31-32-27(25)29(34)33(28)18-20-7-13-23(30)14-8-20/h5-16,28H,3-4,17-18H2,1-2H3,(H,31,32) |
| InChIKey | VTWKPSULYWZXIU-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|