C29H27ClFN3O2 — CID 43858132
3-(4-chlorophenyl)-5-[(4-fluorophenyl)methyl]-4-(4-pentoxyphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 43858132) has the molecular formula C29H27ClFN3O2 and a molecular weight of 504.01 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-[(4-fluorophenyl)methyl]-4-(4-pentoxyphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 3-(4-chlorophenyl)-5-[(4-fluorophenyl)methyl]-4-(4-pentoxyphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 43858132 |
| Molecular Formula | C29H27ClFN3O2 |
| Molecular Weight | 504.01 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 3-(4-chlorophenyl)-5-[(4-fluorophenyl)methyl]-4-(4-pentoxyphenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | CCCCCOc1ccc(C2c3c(-c4ccc(Cl)cc4)n[nH]c3C(=O)N2Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C29H27ClFN3O2/c1-2-3-4-17-36-24-15-9-21(10-16-24)28-25-26(20-7-11-22(30)12-8-20)32-33-27(25)29(35)34(28)18-19-5-13-23(31)14-6-19/h5-16,28H,2-4,17-18H2,1H3,(H,32,33) |
| InChIKey | BJGLCVIHHVLPES-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.01 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|