C30H31N3O2 — CID 43855981
5-[(4-methylphenyl)methyl]-4-(4-pentoxyphenyl)-3-phenyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 43855981) has the molecular formula C30H31N3O2 and a molecular weight of 465.60 g/mol. Its IUPAC name is 5-[(4-methylphenyl)methyl]-4-(4-pentoxyphenyl)-3-phenyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 5-[(4-methylphenyl)methyl]-4-(4-pentoxyphenyl)-3-phenyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 43855981 |
| Molecular Formula | C30H31N3O2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 5-[(4-methylphenyl)methyl]-4-(4-pentoxyphenyl)-3-phenyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | CCCCCOc1ccc(C2c3c(-c4ccccc4)n[nH]c3C(=O)N2Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H31N3O2/c1-3-4-8-19-35-25-17-15-24(16-18-25)29-26-27(23-9-6-5-7-10-23)31-32-28(26)30(34)33(29)20-22-13-11-21(2)12-14-22/h5-7,9-18,29H,3-4,8,19-20H2,1-2H3,(H,31,32) |
| InChIKey | FEEKWQLVKZFZON-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|