C19H13N3O5S — CID 135588130
[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 5-nitro-1-benzothiophene-2-carboxylate (PubChem CID 135588130) has the molecular formula C19H13N3O5S and a molecular weight of 395.40 g/mol. Its IUPAC name is [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 5-nitro-1-benzothiophene-2-carboxylate.
| Compound Name | [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 5-nitro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 135588130 |
| Molecular Formula | C19H13N3O5S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 5-nitro-1-benzothiophene-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1cc2cc([N+](=O)[O-])ccc2s1)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H13N3O5S/c1-10(17-20-14-5-3-2-4-13(14)18(23)21-17)27-19(24)16-9-11-8-12(22(25)26)6-7-15(11)28-16/h2-10H,1H3,(H,20,21,23)/t10-/m0/s1 |
| InChIKey | UPMAHORFSYLQRQ-JTQLQIEISA-N |
| XLogP | 3.96 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|