C21H29N5O4S — CID 135589078
2-[(2Z)-2-[(E)-1-(4-nitrophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-octylacetamide (PubChem CID 135589078) has the molecular formula C21H29N5O4S and a molecular weight of 447.56 g/mol. Its IUPAC name is 2-[(2Z)-2-[(E)-1-(4-nitrophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-octylacetamide.
| Compound Name | 2-[(2Z)-2-[(E)-1-(4-nitrophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-octylacetamide |
|---|---|
| PubChem CID | 135589078 |
| Molecular Formula | C21H29N5O4S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 2-[(2Z)-2-[(E)-1-(4-nitrophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-octylacetamide |
| SMILES | CCCCCCCCNC(=O)CC1S/C(=N\N=C(/C)c2ccc([N+](=O)[O-])cc2)NC1=O |
| InChI | InChI=1S/C21H29N5O4S/c1-3-4-5-6-7-8-13-22-19(27)14-18-20(28)23-21(31-18)25-24-15(2)16-9-11-17(12-10-16)26(29)30/h9-12,18H,3-8,13-14H2,1-2H3,(H,22,27)(H,23,25,28)/b24-15+ |
| InChIKey | YFQDAEVSSGYGMF-BUVRLJJBSA-N |
| XLogP | 3.77 |
| TPSA | 126.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|