C19H19BrN4O3S — CID 135590046
2-[[5-(5-bromo-2-hydroxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenoxyethyl)acetamide (PubChem CID 135590046) has the molecular formula C19H19BrN4O3S and a molecular weight of 463.36 g/mol. Its IUPAC name is 2-[[5-(5-bromo-2-hydroxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-[[5-(5-bromo-2-hydroxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 135590046 |
| Molecular Formula | C19H19BrN4O3S |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | 2-[[5-(5-bromo-2-hydroxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenoxyethyl)acetamide |
| SMILES | Cn1c(SCC(=O)NCCOc2ccccc2)nnc1-c1cc(Br)ccc1O |
| InChI | InChI=1S/C19H19BrN4O3S/c1-24-18(15-11-13(20)7-8-16(15)25)22-23-19(24)28-12-17(26)21-9-10-27-14-5-3-2-4-6-14/h2-8,11,25H,9-10,12H2,1H3,(H,21,26) |
| InChIKey | HWATVUVPVLBORP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|