C22H27N3O6S — CID 135591920
tert-butyl 2-[(3-ethoxy-2-hydroxy-5-nitrophenyl)methylideneamino]-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate (PubChem CID 135591920) has the molecular formula C22H27N3O6S and a molecular weight of 461.54 g/mol. Its IUPAC name is tert-butyl 2-[(3-ethoxy-2-hydroxy-5-nitrophenyl)methylideneamino]-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate.
| Compound Name | tert-butyl 2-[(3-ethoxy-2-hydroxy-5-nitrophenyl)methylideneamino]-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 135591920 |
| Molecular Formula | C22H27N3O6S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | tert-butyl 2-[(3-ethoxy-2-hydroxy-5-nitrophenyl)methylideneamino]-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
| SMILES | CCOc1cc([N+](=O)[O-])cc(C=Nc2sc3c(c2C(=O)OC(C)(C)C)CCN(C)C3)c1O |
| InChI | InChI=1S/C22H27N3O6S/c1-6-30-16-10-14(25(28)29)9-13(19(16)26)11-23-20-18(21(27)31-22(2,3)4)15-7-8-24(5)12-17(15)32-20/h9-11,26H,6-8,12H2,1-5H3 |
| InChIKey | QGBIENVCAYOKIR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|