C6H9N3O — CID 135592941
4-amino-2,5-dimethyl-1H-pyrimidin-6-one (PubChem CID 135592941) has the molecular formula C6H9N3O and a molecular weight of 139.16 g/mol. Its IUPAC name is 4-amino-2,5-dimethyl-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2,5-dimethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135592941 |
| Molecular Formula | C6H9N3O |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.07 |
| IUPAC Name | 4-amino-2,5-dimethyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(N)c(C)c(=O)[nH]1 |
| InChI | InChI=1S/C6H9N3O/c1-3-5(7)8-4(2)9-6(3)10/h1-2H3,(H3,7,8,9,10) |
| InChIKey | FTWYAOBHRPLHQG-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |