C7H10N2O — CID 135591004
2,4,5-trimethyl-1H-pyrimidin-6-one (PubChem CID 135591004) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is 2,4,5-trimethyl-1H-pyrimidin-6-one.
| Compound Name | 2,4,5-trimethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135591004 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 2,4,5-trimethyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(C)c(C)c(=O)[nH]1 |
| InChI | InChI=1S/C7H10N2O/c1-4-5(2)8-6(3)9-7(4)10/h1-3H3,(H,8,9,10) |
| InChIKey | BIXKUCQZIIOIEC-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |