C17H15ClN2O5 — CID 135596003
4-chloro-2-[[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]iminomethyl]-6-nitrophenol (PubChem CID 135596003) has the molecular formula C17H15ClN2O5 and a molecular weight of 362.77 g/mol. Its IUPAC name is 4-chloro-2-[[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]iminomethyl]-6-nitrophenol.
| Compound Name | 4-chloro-2-[[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]iminomethyl]-6-nitrophenol |
|---|---|
| PubChem CID | 135596003 |
| Molecular Formula | C17H15ClN2O5 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 4-chloro-2-[[(1R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]iminomethyl]-6-nitrophenol |
| SMILES | C[C@@H](/N=C/c1cc(Cl)cc([N+](=O)[O-])c1O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H15ClN2O5/c1-10(11-2-3-15-16(7-11)25-5-4-24-15)19-9-12-6-13(18)8-14(17(12)21)20(22)23/h2-3,6-10,21H,4-5H2,1H3/b19-9+/t10-/m1/s1 |
| InChIKey | HDMROUDCQNUYOX-XTTRTJGBSA-N |
| XLogP | 3.91 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|