C16H21N2O2S+ — CID 135597912
[(1S)-2-[(2-hydroxy-5-methoxyphenyl)methylideneamino]-1-thiophen-2-ylethyl]-dimethylazanium (PubChem CID 135597912) has the molecular formula C16H21N2O2S+ and a molecular weight of 305.42 g/mol. Its IUPAC name is [(1S)-2-[(2-hydroxy-5-methoxyphenyl)methylideneamino]-1-thiophen-2-ylethyl]-dimethylazanium.
| Compound Name | [(1S)-2-[(2-hydroxy-5-methoxyphenyl)methylideneamino]-1-thiophen-2-ylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 135597912 |
| Molecular Formula | C16H21N2O2S+ |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | [(1S)-2-[(2-hydroxy-5-methoxyphenyl)methylideneamino]-1-thiophen-2-ylethyl]-dimethylazanium |
| SMILES | COc1ccc(O)c(/C=N/C[C@@H](c2cccs2)[NH+](C)C)c1 |
| InChI | InChI=1S/C16H20N2O2S/c1-18(2)14(16-5-4-8-21-16)11-17-10-12-9-13(20-3)6-7-15(12)19/h4-10,14,19H,11H2,1-3H3/p+1/b17-10+/t14-/m0/s1 |
| InChIKey | FYYPKQOZGPNOOX-FBJMNJBLSA-O |
| XLogP | 1.77 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|