C23H19BrN4O4 — CID 135603385
1-(4-bromo-3-methylphenyl)-6-hydroxy-5-[(E)-[3-methyl-1-(4-methylphenyl)-5-oxopyrazol-4-ylidene]methyl]pyrimidine-2,4-dione (PubChem CID 135603385) has the molecular formula C23H19BrN4O4 and a molecular weight of 495.33 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-6-hydroxy-5-[(E)-[3-methyl-1-(4-methylphenyl)-5-oxopyrazol-4-ylidene]methyl]pyrimidine-2,4-dione.
| Compound Name | 1-(4-bromo-3-methylphenyl)-6-hydroxy-5-[(E)-[3-methyl-1-(4-methylphenyl)-5-oxopyrazol-4-ylidene]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135603385 |
| Molecular Formula | C23H19BrN4O4 |
| Molecular Weight | 495.33 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-6-hydroxy-5-[(E)-[3-methyl-1-(4-methylphenyl)-5-oxopyrazol-4-ylidene]methyl]pyrimidine-2,4-dione |
| SMILES | CC1=NN(c2ccc(C)cc2)C(=O)/C1=C/c1c(O)n(-c2ccc(Br)c(C)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H19BrN4O4/c1-12-4-6-15(7-5-12)28-22(31)17(14(3)26-28)11-18-20(29)25-23(32)27(21(18)30)16-8-9-19(24)13(2)10-16/h4-11,30H,1-3H3,(H,25,29,32)/b17-11+ |
| InChIKey | JTFMJNXOWDRVNM-GZTJUZNOSA-N |
| XLogP | 3.42 |
| TPSA | 107.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|