C23H19BrN4O5 — CID 3457239
1-(4-bromo-2-methylphenyl)-6-hydroxy-5-[[1-(4-methoxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]pyrimidine-2,4-dione (PubChem CID 3457239) has the molecular formula C23H19BrN4O5 and a molecular weight of 511.33 g/mol. Its IUPAC name is 1-(4-bromo-2-methylphenyl)-6-hydroxy-5-[[1-(4-methoxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]pyrimidine-2,4-dione.
| Compound Name | 1-(4-bromo-2-methylphenyl)-6-hydroxy-5-[[1-(4-methoxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3457239 |
| Molecular Formula | C23H19BrN4O5 |
| Molecular Weight | 511.33 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | 1-(4-bromo-2-methylphenyl)-6-hydroxy-5-[[1-(4-methoxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(N2N=C(C)C(=Cc3c(O)n(-c4ccc(Br)cc4C)c(=O)[nH]c3=O)C2=O)cc1 |
| InChI | InChI=1S/C23H19BrN4O5/c1-12-10-14(24)4-9-19(12)27-21(30)18(20(29)25-23(27)32)11-17-13(2)26-28(22(17)31)15-5-7-16(33-3)8-6-15/h4-11,30H,1-3H3,(H,25,29,32) |
| InChIKey | SRDRGXYGSOFKKI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 116.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|