C10H18N4O4 — CID 135603899
N,N'-bis(1-hydroxyimino-2-methylpropan-2-yl)ethane-1,2-diimine oxide (PubChem CID 135603899) has the molecular formula C10H18N4O4 and a molecular weight of 258.28 g/mol. Its IUPAC name is N,N'-bis(1-hydroxyimino-2-methylpropan-2-yl)ethane-1,2-diimine oxide.
| Compound Name | N,N'-bis(1-hydroxyimino-2-methylpropan-2-yl)ethane-1,2-diimine oxide |
|---|---|
| PubChem CID | 135603899 |
| Molecular Formula | C10H18N4O4 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | N,N'-bis(1-hydroxyimino-2-methylpropan-2-yl)ethane-1,2-diimine oxide |
| SMILES | CC(C)(C=NO)/[N+]([O-])=C/C=[N+](\[O-])C(C)(C)C=NO |
| InChI | InChI=1S/C10H18N4O4/c1-9(2,7-11-15)13(17)5-6-14(18)10(3,4)8-12-16/h5-8,15-16H,1-4H3/b11-7?,12-8?,13-5-,14-6- |
| InChIKey | ZAYVCYLYBYGFOQ-JUQHASQISA-N |
| XLogP | 0.63 |
| TPSA | 117.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|