C17H18ClN5O4 — CID 135604791
ethyl (Z)-3-[[5-[(4-chlorophenyl)diazenyl]-1,3-dimethyl-2,6-dioxopyrimidin-4-yl]amino]prop-2-enoate (PubChem CID 135604791) has the molecular formula C17H18ClN5O4 and a molecular weight of 391.82 g/mol. Its IUPAC name is ethyl (Z)-3-[[5-[(4-chlorophenyl)diazenyl]-1,3-dimethyl-2,6-dioxopyrimidin-4-yl]amino]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[[5-[(4-chlorophenyl)diazenyl]-1,3-dimethyl-2,6-dioxopyrimidin-4-yl]amino]prop-2-enoate |
|---|---|
| PubChem CID | 135604791 |
| Molecular Formula | C17H18ClN5O4 |
| Molecular Weight | 391.82 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | ethyl (Z)-3-[[5-[(4-chlorophenyl)diazenyl]-1,3-dimethyl-2,6-dioxopyrimidin-4-yl]amino]prop-2-enoate |
| SMILES | CCOC(=O)/C=C\Nc1c(/N=N/c2ccc(Cl)cc2)c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C17H18ClN5O4/c1-4-27-13(24)9-10-19-15-14(16(25)23(3)17(26)22(15)2)21-20-12-7-5-11(18)6-8-12/h5-10,19H,4H2,1-3H3/b10-9-,21-20+ |
| InChIKey | MHQRCCAHYDXQLA-PZAJOLBZSA-N |
| XLogP | 2.64 |
| TPSA | 107.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.82 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|