C22H22FN3O3 — CID 135605301
1-[4-[(4-fluoro-2-hydroxy-1H-indol-3-yl)methylideneamino]-2-methylphenyl]piperidine-4-carboxylic acid (PubChem CID 135605301) has the molecular formula C22H22FN3O3 and a molecular weight of 395.43 g/mol. Its IUPAC name is 1-[4-[(4-fluoro-2-hydroxy-1H-indol-3-yl)methylideneamino]-2-methylphenyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[4-[(4-fluoro-2-hydroxy-1H-indol-3-yl)methylideneamino]-2-methylphenyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 135605301 |
| Molecular Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 1-[4-[(4-fluoro-2-hydroxy-1H-indol-3-yl)methylideneamino]-2-methylphenyl]piperidine-4-carboxylic acid |
| SMILES | Cc1cc(/N=C/c2c(O)[nH]c3cccc(F)c23)ccc1N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C22H22FN3O3/c1-13-11-15(5-6-19(13)26-9-7-14(8-10-26)22(28)29)24-12-16-20-17(23)3-2-4-18(20)25-21(16)27/h2-6,11-12,14,25,27H,7-10H2,1H3,(H,28,29)/b24-12+ |
| InChIKey | PAHRCDMCHVCXIB-WYMPLXKRSA-N |
| XLogP | 4.37 |
| TPSA | 88.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|