C24H30N4O — CID 135605341
3-[[4-(4-butylpiperazin-1-yl)phenyl]iminomethyl]-4-methyl-1H-indol-2-ol (PubChem CID 135605341) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is 3-[[4-(4-butylpiperazin-1-yl)phenyl]iminomethyl]-4-methyl-1H-indol-2-ol.
| Compound Name | 3-[[4-(4-butylpiperazin-1-yl)phenyl]iminomethyl]-4-methyl-1H-indol-2-ol |
|---|---|
| PubChem CID | 135605341 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 3-[[4-(4-butylpiperazin-1-yl)phenyl]iminomethyl]-4-methyl-1H-indol-2-ol |
| SMILES | CCCCN1CCN(c2ccc(/N=C/c3c(O)[nH]c4cccc(C)c34)cc2)CC1 |
| InChI | InChI=1S/C24H30N4O/c1-3-4-12-27-13-15-28(16-14-27)20-10-8-19(9-11-20)25-17-21-23-18(2)6-5-7-22(23)26-24(21)29/h5-11,17,26,29H,3-4,12-16H2,1-2H3/b25-17+ |
| InChIKey | JNKIAJDGXGXSID-KOEQRZSOSA-N |
| XLogP | 4.85 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|