C33H33N7O3 — CID 135441301
N-[3-[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indole-6-carbonyl]phenyl]-2,5-dimethylpyrazole-3-carboxamide (PubChem CID 135441301) has the molecular formula C33H33N7O3 and a molecular weight of 575.67 g/mol. Its IUPAC name is N-[3-[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indole-6-carbonyl]phenyl]-2,5-dimethylpyrazole-3-carboxamide.
| Compound Name | N-[3-[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indole-6-carbonyl]phenyl]-2,5-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135441301 |
| Molecular Formula | C33H33N7O3 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | N-[3-[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indole-6-carbonyl]phenyl]-2,5-dimethylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(C(=O)c3ccc4c(/C=N/c5ccc(N6CCN(C)CC6)cc5)c(O)[nH]c4c3)c2)n(C)n1 |
| InChI | InChI=1S/C33H33N7O3/c1-21-17-30(39(3)37-21)33(43)35-25-6-4-5-22(18-25)31(41)23-7-12-27-28(32(42)36-29(27)19-23)20-34-24-8-10-26(11-9-24)40-15-13-38(2)14-16-40/h4-12,17-20,36,42H,13-16H2,1-3H3,(H,35,43)/b34-20+ |
| InChIKey | XEVQWMWTSLMCKE-QXUDOOCXSA-N |
| XLogP | 4.90 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|