C32H30N6O4 — CID 152755369
N-[3-[2-hydroxy-3-[(4-morpholin-4-ylphenyl)iminomethyl]-1H-indole-5-carbonyl]phenyl]-2,5-dimethylpyrazole-3-carboxamide (PubChem CID 152755369) has the molecular formula C32H30N6O4 and a molecular weight of 562.63 g/mol. Its IUPAC name is N-[3-[2-hydroxy-3-[(4-morpholin-4-ylphenyl)iminomethyl]-1H-indole-5-carbonyl]phenyl]-2,5-dimethylpyrazole-3-carboxamide.
| Compound Name | N-[3-[2-hydroxy-3-[(4-morpholin-4-ylphenyl)iminomethyl]-1H-indole-5-carbonyl]phenyl]-2,5-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 152755369 |
| Molecular Formula | C32H30N6O4 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | N-[3-[2-hydroxy-3-[(4-morpholin-4-ylphenyl)iminomethyl]-1H-indole-5-carbonyl]phenyl]-2,5-dimethylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(C(=O)c3ccc4[nH]c(O)c(/C=N/c5ccc(N6CCOCC6)cc5)c4c3)c2)n(C)n1 |
| InChI | InChI=1S/C32H30N6O4/c1-20-16-29(37(2)36-20)32(41)34-24-5-3-4-21(17-24)30(39)22-6-11-28-26(18-22)27(31(40)35-28)19-33-23-7-9-25(10-8-23)38-12-14-42-15-13-38/h3-11,16-19,35,40H,12-15H2,1-2H3,(H,34,41)/b33-19+ |
| InChIKey | PLPSGNGHXTXWKV-HNSNBQBZSA-N |
| XLogP | 4.99 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|