C36H41N7O2 — CID 162161132
2-tert-butyl-N-[4-[[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indol-5-yl]methyl]phenyl]-5-methylpyrazole-3-carboxamide (PubChem CID 162161132) has the molecular formula C36H41N7O2 and a molecular weight of 603.77 g/mol. Its IUPAC name is 2-tert-butyl-N-[4-[[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indol-5-yl]methyl]phenyl]-5-methylpyrazole-3-carboxamide.
| Compound Name | 2-tert-butyl-N-[4-[[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indol-5-yl]methyl]phenyl]-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 162161132 |
| Molecular Formula | C36H41N7O2 |
| Molecular Weight | 603.77 g/mol |
| Exact Mass | 603.33 |
| IUPAC Name | 2-tert-butyl-N-[4-[[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indol-5-yl]methyl]phenyl]-5-methylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(Cc3ccc4[nH]c(O)c(/C=N/c5ccc(N6CCN(C)CC6)cc5)c4c3)cc2)n(C(C)(C)C)n1 |
| InChI | InChI=1S/C36H41N7O2/c1-24-20-33(43(40-24)36(2,3)4)35(45)38-28-9-6-25(7-10-28)21-26-8-15-32-30(22-26)31(34(44)39-32)23-37-27-11-13-29(14-12-27)42-18-16-41(5)17-19-42/h6-15,20,22-23,39,44H,16-19,21H2,1-5H3,(H,38,45)/b37-23+ |
| InChIKey | VDTHCNDTKHNELH-GUBAARJWSA-N |
| XLogP | 6.48 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.77 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|