C28H26N4O4 — CID 135441376
N-[3-[2-hydroxy-3-[(4-morpholin-4-ylphenyl)iminomethyl]-1H-indole-5-carbonyl]phenyl]acetamide (PubChem CID 135441376) has the molecular formula C28H26N4O4 and a molecular weight of 482.54 g/mol. Its IUPAC name is N-[3-[2-hydroxy-3-[(4-morpholin-4-ylphenyl)iminomethyl]-1H-indole-5-carbonyl]phenyl]acetamide.
| Compound Name | N-[3-[2-hydroxy-3-[(4-morpholin-4-ylphenyl)iminomethyl]-1H-indole-5-carbonyl]phenyl]acetamide |
|---|---|
| PubChem CID | 135441376 |
| Molecular Formula | C28H26N4O4 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | N-[3-[2-hydroxy-3-[(4-morpholin-4-ylphenyl)iminomethyl]-1H-indole-5-carbonyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(C(=O)c2ccc3[nH]c(O)c(/C=N/c4ccc(N5CCOCC5)cc4)c3c2)c1 |
| InChI | InChI=1S/C28H26N4O4/c1-18(33)30-22-4-2-3-19(15-22)27(34)20-5-10-26-24(16-20)25(28(35)31-26)17-29-21-6-8-23(9-7-21)32-11-13-36-14-12-32/h2-10,15-17,31,35H,11-14H2,1H3,(H,30,33)/b29-17+ |
| InChIKey | DUNJYHPURPCSFO-STBIYBPSSA-N |
| XLogP | 4.65 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|