C31H29N5O4S2 — CID 136647240
N-[3-[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indole-6-carbonyl]phenyl]thiophene-3-sulfonamide (PubChem CID 136647240) has the molecular formula C31H29N5O4S2 and a molecular weight of 599.74 g/mol. Its IUPAC name is N-[3-[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indole-6-carbonyl]phenyl]thiophene-3-sulfonamide.
| Compound Name | N-[3-[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indole-6-carbonyl]phenyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 136647240 |
| Molecular Formula | C31H29N5O4S2 |
| Molecular Weight | 599.74 g/mol |
| Exact Mass | 599.17 |
| IUPAC Name | N-[3-[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indole-6-carbonyl]phenyl]thiophene-3-sulfonamide |
| SMILES | CN1CCN(c2ccc(/N=C/c3c(O)[nH]c4cc(C(=O)c5cccc(NS(=O)(=O)c6ccsc6)c5)ccc34)cc2)CC1 |
| InChI | InChI=1S/C31H29N5O4S2/c1-35-12-14-36(15-13-35)25-8-6-23(7-9-25)32-19-28-27-10-5-22(18-29(27)33-31(28)38)30(37)21-3-2-4-24(17-21)34-42(39,40)26-11-16-41-20-26/h2-11,16-20,33-34,38H,12-15H2,1H3/b32-19+ |
| InChIKey | ZRQFOYYXFMRXKI-BIZUNTBRSA-N |
| XLogP | 5.47 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.74 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|