C36H36N6O5 — CID 91035542
1-(3,5-dimethoxyphenyl)-3-[3-[3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindole-6-carbonyl]phenyl]urea (PubChem CID 91035542) has the molecular formula C36H36N6O5 and a molecular weight of 632.72 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-[3-[3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindole-6-carbonyl]phenyl]urea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-[3-[3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindole-6-carbonyl]phenyl]urea |
|---|---|
| PubChem CID | 91035542 |
| Molecular Formula | C36H36N6O5 |
| Molecular Weight | 632.72 g/mol |
| Exact Mass | 632.27 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-[3-[3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindole-6-carbonyl]phenyl]urea |
| SMILES | COc1cc(NC(=O)Nc2cccc(C(=O)c3ccc4c(c3)NC(=O)C4/C=N/c3ccc(N4CCN(C)CC4)cc3)c2)cc(OC)c1 |
| InChI | InChI=1S/C36H36N6O5/c1-41-13-15-42(16-14-41)28-10-8-25(9-11-28)37-22-32-31-12-7-24(18-33(31)40-35(32)44)34(43)23-5-4-6-26(17-23)38-36(45)39-27-19-29(46-2)21-30(20-27)47-3/h4-12,17-22,32H,13-16H2,1-3H3,(H,40,44)(H2,38,39,45)/b37-22+ |
| InChIKey | FJJZGORYAKBTDK-SEBMTOOBSA-N |
| XLogP | 5.77 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.72 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|