C32H30N6O3S — CID 90882261
2-methyl-N-[3-[3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindole-6-carbonyl]phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 90882261) has the molecular formula C32H30N6O3S and a molecular weight of 578.70 g/mol. Its IUPAC name is 2-methyl-N-[3-[3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindole-6-carbonyl]phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-methyl-N-[3-[3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindole-6-carbonyl]phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 90882261 |
| Molecular Formula | C32H30N6O3S |
| Molecular Weight | 578.70 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | 2-methyl-N-[3-[3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindole-6-carbonyl]phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2cccc(C(=O)c3ccc4c(c3)NC(=O)C4/C=N/c3ccc(N4CCN(C)CC4)cc3)c2)cs1 |
| InChI | InChI=1S/C32H30N6O3S/c1-20-34-29(19-42-20)32(41)35-24-5-3-4-21(16-24)30(39)22-6-11-26-27(31(40)36-28(26)17-22)18-33-23-7-9-25(10-8-23)38-14-12-37(2)13-15-38/h3-11,16-19,27H,12-15H2,1-2H3,(H,35,41)(H,36,40)/b33-18+ |
| InChIKey | JVVCWBPIHVJEMW-DPNNOFEESA-N |
| XLogP | 5.12 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.70 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|