C32H33N7O2 — CID 90924829
1-methyl-N-[3-[[3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindol-5-yl]methyl]phenyl]pyrazole-4-carboxamide (PubChem CID 90924829) has the molecular formula C32H33N7O2 and a molecular weight of 547.66 g/mol. Its IUPAC name is 1-methyl-N-[3-[[3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindol-5-yl]methyl]phenyl]pyrazole-4-carboxamide.
| Compound Name | 1-methyl-N-[3-[[3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindol-5-yl]methyl]phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 90924829 |
| Molecular Formula | C32H33N7O2 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | 1-methyl-N-[3-[[3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindol-5-yl]methyl]phenyl]pyrazole-4-carboxamide |
| SMILES | CN1CCN(c2ccc(/N=C/C3C(=O)Nc4ccc(Cc5cccc(NC(=O)c6cnn(C)c6)c5)cc43)cc2)CC1 |
| InChI | InChI=1S/C32H33N7O2/c1-37-12-14-39(15-13-37)27-9-7-25(8-10-27)33-20-29-28-18-23(6-11-30(28)36-32(29)41)16-22-4-3-5-26(17-22)35-31(40)24-19-34-38(2)21-24/h3-11,17-21,29H,12-16H2,1-2H3,(H,35,40)(H,36,41)/b33-20+ |
| InChIKey | CRBGZNVUYYHGCF-FMFFXOCNSA-N |
| XLogP | 4.45 |
| TPSA | 94.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|