C32H31N5O2S — CID 91176990
N-[4-[[3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindol-5-yl]methyl]phenyl]thiophene-2-carboxamide (PubChem CID 91176990) has the molecular formula C32H31N5O2S and a molecular weight of 549.70 g/mol. Its IUPAC name is N-[4-[[3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindol-5-yl]methyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[[3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindol-5-yl]methyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 91176990 |
| Molecular Formula | C32H31N5O2S |
| Molecular Weight | 549.70 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | N-[4-[[3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindol-5-yl]methyl]phenyl]thiophene-2-carboxamide |
| SMILES | CN1CCN(c2ccc(/N=C/C3C(=O)Nc4ccc(Cc5ccc(NC(=O)c6cccs6)cc5)cc43)cc2)CC1 |
| InChI | InChI=1S/C32H31N5O2S/c1-36-14-16-37(17-15-36)26-11-9-24(10-12-26)33-21-28-27-20-23(6-13-29(27)35-31(28)38)19-22-4-7-25(8-5-22)34-32(39)30-3-2-18-40-30/h2-13,18,20-21,28H,14-17,19H2,1H3,(H,34,39)(H,35,38)/b33-21+ |
| InChIKey | ALSIXFINLHHYDS-QNKGDIEWSA-N |
| XLogP | 5.78 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.70 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|