C32H29N5O3S — CID 140548059
N-[4-[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indole-5-carbonyl]phenyl]thiophene-2-carboxamide (PubChem CID 140548059) has the molecular formula C32H29N5O3S and a molecular weight of 563.68 g/mol. Its IUPAC name is N-[4-[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indole-5-carbonyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indole-5-carbonyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 140548059 |
| Molecular Formula | C32H29N5O3S |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | N-[4-[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indole-5-carbonyl]phenyl]thiophene-2-carboxamide |
| SMILES | CN1CCN(c2ccc(/N=C/c3c(O)[nH]c4ccc(C(=O)c5ccc(NC(=O)c6cccs6)cc5)cc34)cc2)CC1 |
| InChI | InChI=1S/C32H29N5O3S/c1-36-14-16-37(17-15-36)25-11-9-23(10-12-25)33-20-27-26-19-22(6-13-28(26)35-31(27)39)30(38)21-4-7-24(8-5-21)34-32(40)29-3-2-18-41-29/h2-13,18-20,35,39H,14-17H2,1H3,(H,34,40)/b33-20+ |
| InChIKey | FBXORVVCQXRICR-FMFFXOCNSA-N |
| XLogP | 5.92 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|