C36H39N7O3 — CID 160764100
2-tert-butyl-N-[4-[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indole-5-carbonyl]phenyl]-5-methylpyrazole-3-carboxamide (PubChem CID 160764100) has the molecular formula C36H39N7O3 and a molecular weight of 617.75 g/mol. Its IUPAC name is 2-tert-butyl-N-[4-[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indole-5-carbonyl]phenyl]-5-methylpyrazole-3-carboxamide.
| Compound Name | 2-tert-butyl-N-[4-[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indole-5-carbonyl]phenyl]-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 160764100 |
| Molecular Formula | C36H39N7O3 |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 617.31 |
| IUPAC Name | 2-tert-butyl-N-[4-[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indole-5-carbonyl]phenyl]-5-methylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(C(=O)c3ccc4[nH]c(O)c(/C=N/c5ccc(N6CCN(C)CC6)cc5)c4c3)cc2)n(C(C)(C)C)n1 |
| InChI | InChI=1S/C36H39N7O3/c1-23-20-32(43(40-23)36(2,3)4)35(46)38-27-9-6-24(7-10-27)33(44)25-8-15-31-29(21-25)30(34(45)39-31)22-37-26-11-13-28(14-12-26)42-18-16-41(5)17-19-42/h6-15,20-22,39,45H,16-19H2,1-5H3,(H,38,46)/b37-22+ |
| InChIKey | XMVVCRYPJSFVPM-SEBMTOOBSA-N |
| XLogP | 6.12 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|