C35H38N6O3 — CID 152762080
2-tert-butyl-N-[4-[[2-hydroxy-3-[(4-morpholin-4-ylphenyl)iminomethyl]-1H-indol-5-yl]methyl]phenyl]-5-methylpyrazole-3-carboxamide (PubChem CID 152762080) has the molecular formula C35H38N6O3 and a molecular weight of 590.73 g/mol. Its IUPAC name is 2-tert-butyl-N-[4-[[2-hydroxy-3-[(4-morpholin-4-ylphenyl)iminomethyl]-1H-indol-5-yl]methyl]phenyl]-5-methylpyrazole-3-carboxamide.
| Compound Name | 2-tert-butyl-N-[4-[[2-hydroxy-3-[(4-morpholin-4-ylphenyl)iminomethyl]-1H-indol-5-yl]methyl]phenyl]-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 152762080 |
| Molecular Formula | C35H38N6O3 |
| Molecular Weight | 590.73 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | 2-tert-butyl-N-[4-[[2-hydroxy-3-[(4-morpholin-4-ylphenyl)iminomethyl]-1H-indol-5-yl]methyl]phenyl]-5-methylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(Cc3ccc4[nH]c(O)c(/C=N/c5ccc(N6CCOCC6)cc5)c4c3)cc2)n(C(C)(C)C)n1 |
| InChI | InChI=1S/C35H38N6O3/c1-23-19-32(41(39-23)35(2,3)4)34(43)37-27-8-5-24(6-9-27)20-25-7-14-31-29(21-25)30(33(42)38-31)22-36-26-10-12-28(13-11-26)40-15-17-44-18-16-40/h5-14,19,21-22,38,42H,15-18,20H2,1-4H3,(H,37,43)/b36-22+ |
| InChIKey | QCNJAAVQPGBJEB-HPNXWYHWSA-N |
| XLogP | 6.56 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.73 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|