C31H29N5O4S2 — CID 90920577
N-[3-[3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindole-6-carbonyl]phenyl]thiophene-2-sulfonamide (PubChem CID 90920577) has the molecular formula C31H29N5O4S2 and a molecular weight of 599.74 g/mol. Its IUPAC name is N-[3-[3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindole-6-carbonyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-[3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindole-6-carbonyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 90920577 |
| Molecular Formula | C31H29N5O4S2 |
| Molecular Weight | 599.74 g/mol |
| Exact Mass | 599.17 |
| IUPAC Name | N-[3-[3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2-oxo-1,3-dihydroindole-6-carbonyl]phenyl]thiophene-2-sulfonamide |
| SMILES | CN1CCN(c2ccc(/N=C/C3C(=O)Nc4cc(C(=O)c5cccc(NS(=O)(=O)c6cccs6)c5)ccc43)cc2)CC1 |
| InChI | InChI=1S/C31H29N5O4S2/c1-35-13-15-36(16-14-35)25-10-8-23(9-11-25)32-20-27-26-12-7-22(19-28(26)33-31(27)38)30(37)21-4-2-5-24(18-21)34-42(39,40)29-6-3-17-41-29/h2-12,17-20,27,34H,13-16H2,1H3,(H,33,38)/b32-20+ |
| InChIKey | PIQXXNKITDIGFJ-UZWMFBFFSA-N |
| XLogP | 4.97 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.74 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|