C21H23BrN4O — CID 90710514
6-bromo-4-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2,4-dihydro-1H-isoquinolin-3-one (PubChem CID 90710514) has the molecular formula C21H23BrN4O and a molecular weight of 427.35 g/mol. Its IUPAC name is 6-bromo-4-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2,4-dihydro-1H-isoquinolin-3-one.
| Compound Name | 6-bromo-4-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2,4-dihydro-1H-isoquinolin-3-one |
|---|---|
| PubChem CID | 90710514 |
| Molecular Formula | C21H23BrN4O |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 6-bromo-4-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-2,4-dihydro-1H-isoquinolin-3-one |
| SMILES | CN1CCN(c2ccc(/N=C/C3C(=O)NCc4ccc(Br)cc43)cc2)CC1 |
| InChI | InChI=1S/C21H23BrN4O/c1-25-8-10-26(11-9-25)18-6-4-17(5-7-18)23-14-20-19-12-16(22)3-2-15(19)13-24-21(20)27/h2-7,12,14,20H,8-11,13H2,1H3,(H,24,27)/b23-14+ |
| InChIKey | QQZPGCULKLIMLR-OEAKJJBVSA-N |
| XLogP | 3.32 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|