C35H34N6O4 — CID 69153230
1-(2-methoxyphenyl)-3-[3-[3-[[4-(4-methylpiperazin-1-yl)anilino]methylidene]-2-oxo-1H-indole-6-carbonyl]phenyl]urea (PubChem CID 69153230) has the molecular formula C35H34N6O4 and a molecular weight of 602.70 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[3-[3-[[4-(4-methylpiperazin-1-yl)anilino]methylidene]-2-oxo-1H-indole-6-carbonyl]phenyl]urea.
| Compound Name | 1-(2-methoxyphenyl)-3-[3-[3-[[4-(4-methylpiperazin-1-yl)anilino]methylidene]-2-oxo-1H-indole-6-carbonyl]phenyl]urea |
|---|---|
| PubChem CID | 69153230 |
| Molecular Formula | C35H34N6O4 |
| Molecular Weight | 602.70 g/mol |
| Exact Mass | 602.26 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[3-[3-[[4-(4-methylpiperazin-1-yl)anilino]methylidene]-2-oxo-1H-indole-6-carbonyl]phenyl]urea |
| SMILES | COc1ccccc1NC(=O)Nc1cccc(C(=O)c2ccc3c(c2)NC(=O)C3=CNc2ccc(N3CCN(C)CC3)cc2)c1 |
| InChI | InChI=1S/C35H34N6O4/c1-40-16-18-41(19-17-40)27-13-11-25(12-14-27)36-22-29-28-15-10-24(21-31(28)38-34(29)43)33(42)23-6-5-7-26(20-23)37-35(44)39-30-8-3-4-9-32(30)45-2/h3-15,20-22,36H,16-19H2,1-2H3,(H,38,43)(H2,37,39,44) |
| InChIKey | ISPQBWRILWJCJM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.70 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|