C34H32N6O3 — CID 69177712
1-[3-[(3E)-3-[[4-(4-methylpiperazin-1-yl)anilino]methylidene]-2-oxo-1H-indole-6-carbonyl]phenyl]-3-phenylurea (PubChem CID 69177712) has the molecular formula C34H32N6O3 and a molecular weight of 572.67 g/mol. Its IUPAC name is 1-[3-[(3E)-3-[[4-(4-methylpiperazin-1-yl)anilino]methylidene]-2-oxo-1H-indole-6-carbonyl]phenyl]-3-phenylurea.
| Compound Name | 1-[3-[(3E)-3-[[4-(4-methylpiperazin-1-yl)anilino]methylidene]-2-oxo-1H-indole-6-carbonyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 69177712 |
| Molecular Formula | C34H32N6O3 |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | 1-[3-[(3E)-3-[[4-(4-methylpiperazin-1-yl)anilino]methylidene]-2-oxo-1H-indole-6-carbonyl]phenyl]-3-phenylurea |
| SMILES | CN1CCN(c2ccc(N/C=C3/C(=O)Nc4cc(C(=O)c5cccc(NC(=O)Nc6ccccc6)c5)ccc43)cc2)CC1 |
| InChI | InChI=1S/C34H32N6O3/c1-39-16-18-40(19-17-39)28-13-11-25(12-14-28)35-22-30-29-15-10-24(21-31(29)38-33(30)42)32(41)23-6-5-9-27(20-23)37-34(43)36-26-7-3-2-4-8-26/h2-15,20-22,35H,16-19H2,1H3,(H,38,42)(H2,36,37,43)/b30-22+ |
| InChIKey | PNNVFNIRZHIAFK-JBASAIQMSA-N |
| XLogP | 5.72 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|