C36H35N5O5 — CID 69154163
2,4-dimethoxy-N-[3-[3-[[4-(4-methylpiperazin-1-yl)anilino]methylidene]-2-oxo-1H-indole-6-carbonyl]phenyl]benzamide (PubChem CID 69154163) has the molecular formula C36H35N5O5 and a molecular weight of 617.71 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[3-[3-[[4-(4-methylpiperazin-1-yl)anilino]methylidene]-2-oxo-1H-indole-6-carbonyl]phenyl]benzamide.
| Compound Name | 2,4-dimethoxy-N-[3-[3-[[4-(4-methylpiperazin-1-yl)anilino]methylidene]-2-oxo-1H-indole-6-carbonyl]phenyl]benzamide |
|---|---|
| PubChem CID | 69154163 |
| Molecular Formula | C36H35N5O5 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.26 |
| IUPAC Name | 2,4-dimethoxy-N-[3-[3-[[4-(4-methylpiperazin-1-yl)anilino]methylidene]-2-oxo-1H-indole-6-carbonyl]phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(C(=O)c3ccc4c(c3)NC(=O)C4=CNc3ccc(N4CCN(C)CC4)cc3)c2)c(OC)c1 |
| InChI | InChI=1S/C36H35N5O5/c1-40-15-17-41(18-16-40)27-10-8-25(9-11-27)37-22-31-29-13-7-24(20-32(29)39-36(31)44)34(42)23-5-4-6-26(19-23)38-35(43)30-14-12-28(45-2)21-33(30)46-3/h4-14,19-22,37H,15-18H2,1-3H3,(H,38,43)(H,39,44) |
| InChIKey | UCCCLPNTRXELNM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|