C25H28N4O4 — CID 134214502
N-[3-[5-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]furan-3-carbonyl]phenyl]acetamide (PubChem CID 134214502) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-[3-[5-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]furan-3-carbonyl]phenyl]acetamide.
| Compound Name | N-[3-[5-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]furan-3-carbonyl]phenyl]acetamide |
|---|---|
| PubChem CID | 134214502 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-[3-[5-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]furan-3-carbonyl]phenyl]acetamide |
| SMILES | COc1cc(N2CCN(C)CC2)ccc1Nc1cc(C(=O)c2cccc(NC(C)=O)c2)co1 |
| InChI | InChI=1S/C25H28N4O4/c1-17(30)26-20-6-4-5-18(13-20)25(31)19-14-24(33-16-19)27-22-8-7-21(15-23(22)32-3)29-11-9-28(2)10-12-29/h4-8,13-16,27H,9-12H2,1-3H3,(H,26,30) |
| InChIKey | ZBYCAPRSWDCGKH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |