C25H21N3O5 — CID 135441253
N-[4-[2-hydroxy-3-[(3-hydroxy-4-methoxyphenyl)iminomethyl]-1H-indole-6-carbonyl]phenyl]acetamide (PubChem CID 135441253) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is N-[4-[2-hydroxy-3-[(3-hydroxy-4-methoxyphenyl)iminomethyl]-1H-indole-6-carbonyl]phenyl]acetamide.
| Compound Name | N-[4-[2-hydroxy-3-[(3-hydroxy-4-methoxyphenyl)iminomethyl]-1H-indole-6-carbonyl]phenyl]acetamide |
|---|---|
| PubChem CID | 135441253 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | N-[4-[2-hydroxy-3-[(3-hydroxy-4-methoxyphenyl)iminomethyl]-1H-indole-6-carbonyl]phenyl]acetamide |
| SMILES | COc1ccc(/N=C/c2c(O)[nH]c3cc(C(=O)c4ccc(NC(C)=O)cc4)ccc23)cc1O |
| InChI | InChI=1S/C25H21N3O5/c1-14(29)27-17-6-3-15(4-7-17)24(31)16-5-9-19-20(25(32)28-21(19)11-16)13-26-18-8-10-23(33-2)22(30)12-18/h3-13,28,30,32H,1-2H3,(H,27,29)/b26-13+ |
| InChIKey | FBPKYLADFWLMPX-LGJNPRDNSA-N |
| XLogP | 4.53 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|