C18H17N3O3 — CID 138462659
methyl 2-hydroxy-3-[[4-(methylamino)phenyl]iminomethyl]-1H-indole-6-carboxylate (PubChem CID 138462659) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[[4-(methylamino)phenyl]iminomethyl]-1H-indole-6-carboxylate.
| Compound Name | methyl 2-hydroxy-3-[[4-(methylamino)phenyl]iminomethyl]-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 138462659 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | methyl 2-hydroxy-3-[[4-(methylamino)phenyl]iminomethyl]-1H-indole-6-carboxylate |
| SMILES | CNc1ccc(/N=C/c2c(O)[nH]c3cc(C(=O)OC)ccc23)cc1 |
| InChI | InChI=1S/C18H17N3O3/c1-19-12-4-6-13(7-5-12)20-10-15-14-8-3-11(18(23)24-2)9-16(14)21-17(15)22/h3-10,19,21-22H,1-2H3/b20-10+ |
| InChIKey | NORVLFVSVZNGOO-KEBDBYFISA-N |
| XLogP | 3.45 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|